giuliapena08888 giuliapena08888

23-06-2021
Chemistry

contestada

31. Adding an additional oxygen atom to 02 creates....
ozone
oxygen
methane
CFC

PLEASE HELP

Respuesta :

dhuidbehehs dhuidbehehs

23-06-2021

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

Answer Link

Otras preguntas

Neeta bought 2 and 3/5 liter of milk from the market.To make it 3 liters, how much more does she need?

In his pamphlet Common Sense, Thomas Paine urged American colonists to (1) establish their own nation (2) pay their colonial taxes (3) obey the laws of Parliame

Who, if any, in JFK's inner circle argued against the plans for the Bay of Pigs invasion?

In the sentence "Mary caught a frog," the common noun serves as A. the predicate of the sentence. B. the object of the sentence. C.

There are two different species of finch that live on the same small island, species A and species B. Both species successfully feed and reproduce on the island

At the tips of shoots and roots can be found what type of tissue? a. ground b. vascular c. dermal d. meristematic

Explain the relationship between individual and market demand

Given the balanced equation representing a reaction: Cu + S==> CuS + energy Which statement explains why the energy term is written to the right of the arrow

Which article of the United States Constitution outlines the structure and powers of the executive branch?

Where did the Velvet Revolution occur? A. Poland B. Hungary C. Romania D. Czechoslovakia